k/node.rs
1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 101 102 103 104 105 106 107 108 109 110 111 112 113 114 115 116 117 118 119 120 121 122 123 124 125 126 127 128 129 130 131 132 133 134 135 136 137 138 139 140 141 142 143 144 145 146 147 148 149 150 151 152 153 154 155 156 157 158 159 160 161 162 163 164 165 166 167 168 169 170 171 172 173 174 175 176 177 178 179 180 181 182 183 184 185 186 187 188 189 190 191 192 193 194 195 196 197 198 199 200 201 202 203 204 205 206 207 208 209 210 211 212 213 214 215 216 217 218 219 220 221 222 223 224 225 226 227 228 229 230 231 232 233 234 235 236 237 238 239 240 241 242 243 244 245 246 247 248 249 250 251 252 253 254 255 256 257 258 259 260 261 262 263 264 265 266 267 268 269 270 271 272 273 274 275 276 277 278 279 280 281 282 283 284 285 286 287 288 289 290 291 292 293 294 295 296 297 298 299 300 301 302 303 304 305 306 307 308 309 310 311 312 313 314 315 316 317 318 319 320 321 322 323 324 325 326 327 328 329 330 331 332 333 334 335 336 337 338 339 340 341 342 343 344 345 346 347 348 349 350 351 352 353 354 355 356 357 358 359 360 361 362 363 364 365 366 367 368 369 370 371 372 373 374 375 376 377 378 379 380 381 382 383 384 385 386 387 388 389 390 391 392 393 394 395 396 397 398 399 400 401 402 403 404 405 406 407 408 409 410 411 412 413 414 415 416 417 418 419 420 421 422 423 424 425 426 427 428 429 430 431 432 433 434 435 436 437 438 439 440 441 442 443 444 445 446 447 448 449 450 451 452 453 454 455 456 457 458 459 460 461 462 463 464 465 466 467 468 469 470 471 472 473 474 475 476 477 478 479 480 481 482 483 484 485 486 487 488 489 490 491 492 493 494 495 496 497 498 499 500 501 502 503 504 505 506 507 508 509 510 511 512 513 514 515 516 517 518 519 520 521 522 523 524 525 526 527 528 529 530 531 532 533 534 535 536 537 538 539 540 541 542 543 544 545 546 547 548 549 550 551 552 553 554 555 556 557 558 559 560 561 562 563 564 565 566 567 568 569 570 571 572 573 574 575 576 577 578 579 580 581 582 583 584 585 586 587 588 589 590 591 592 593 594 595 596 597 598 599 600 601
/*
Copyright 2017 Takashi Ogura
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
*/
//! graph structure for kinematic chain
use na::{Isometry3, RealField, Translation3, UnitQuaternion};
use nalgebra as na;
use simba::scalar::SubsetOf;
use std::fmt::{self, Display};
use std::ops::Deref;
use std::sync::{Arc, Mutex, MutexGuard, Weak};
use super::errors::*;
use super::iterator::*;
use super::joint::*;
use super::link::*;
type WeakNode<T> = Weak<Mutex<NodeImpl<T>>>;
/// Node for joint tree struct
#[derive(Debug)]
pub struct NodeImpl<T>
where
T: RealField,
{
pub parent: Option<WeakNode<T>>,
pub children: Vec<Node<T>>,
pub joint: Joint<T>,
pub mimic_parent: Option<WeakNode<T>>,
pub mimic_children: Vec<Node<T>>,
pub mimic: Option<Mimic<T>>,
pub link: Option<Link<T>>,
}
/// Parts of `Chain`
///
/// It contains joint, joint (transform), and parent/children.
#[derive(Debug)]
pub struct Node<T: RealField>(pub(crate) Arc<Mutex<NodeImpl<T>>>);
impl<T> Node<T>
where
T: RealField + SubsetOf<f64>,
{
pub(crate) fn from_arc(arc_mutex_node: Arc<Mutex<NodeImpl<T>>>) -> Self {
Node(arc_mutex_node)
}
pub fn new(joint: Joint<T>) -> Self {
Node::<T>(Arc::new(Mutex::new(NodeImpl {
parent: None,
children: Vec::new(),
joint,
mimic_parent: None,
mimic_children: Vec::new(),
mimic: None,
link: None,
})))
}
pub(crate) fn lock(&self) -> MutexGuard<'_, NodeImpl<T>> {
self.0.lock().unwrap()
}
pub fn joint(&self) -> JointRefGuard<'_, T> {
JointRefGuard { guard: self.lock() }
}
pub fn joint_position(&self) -> Option<T> {
self.lock().joint.joint_position()
}
pub fn parent(&self) -> Option<Node<T>> {
match self.lock().parent {
Some(ref weak) => weak.upgrade().map(Node::from_arc),
None => None,
}
}
pub fn children(&self) -> ChildrenRefGuard<'_, T> {
ChildrenRefGuard { guard: self.lock() }
}
/// iter from the end to root, it contains `nodes[id]` itself
#[inline]
pub fn iter_ancestors(&self) -> Ancestors<T> {
Ancestors::new(Some(self.clone()))
}
/// iter to the end, it contains `nodes[id]` itself
#[inline]
pub fn iter_descendants(&self) -> Descendants<T> {
Descendants::new(vec![self.clone()])
}
/// Set parent and child relations at same time
pub fn set_parent(&self, parent: &Node<T>) {
self.lock().parent = Some(Arc::downgrade(&parent.0));
parent.0.lock().unwrap().children.push(self.clone());
}
/// Remove parent and child relations at same time
pub fn remove_parent(&self, parent: &Node<T>) {
self.lock().parent = None;
parent.0.lock().unwrap().children.retain(|x| *x != *self);
}
/// # Examples
///
/// ```
/// use k::*;
///
/// let l0 = k::NodeBuilder::<f32>::new().into_node();
/// let l1 = k::NodeBuilder::new().into_node();
/// l1.set_parent(&l0);
/// assert!(l0.is_root());
/// assert!(!l1.is_root());
/// ```
pub fn is_root(&self) -> bool {
self.lock().parent.is_none()
}
/// # Examples
///
/// ```
/// let l0 = k::NodeBuilder::<f64>::new().into_node();
/// let l1 = k::NodeBuilder::new().into_node();
/// l1.set_parent(&l0);
/// assert!(!l0.is_end());
/// assert!(l1.is_end());
/// ```
pub fn is_end(&self) -> bool {
self.0.lock().unwrap().children.is_empty()
}
/// Set the origin transform of the joint
#[inline]
pub fn set_origin(&self, trans: Isometry3<T>) {
self.lock().joint.set_origin(trans);
}
/// Get the origin transform of the joint
#[inline]
pub fn origin(&self) -> Isometry3<T> {
self.joint().origin().clone()
}
/// Set the position (angle) of the joint
///
/// If position is out of limit, it returns Err.
///
/// # Examples
///
/// ```
/// use k::*;
/// let l0 = NodeBuilder::new()
/// .joint_type(JointType::Linear{axis: Vector3::z_axis()})
/// .limits(Some((0.0..=2.0).into()))
/// .into_node();
/// assert!(l0.set_joint_position(1.0).is_ok());
/// assert!(l0.set_joint_position(-1.0).is_err());
/// ```
///
/// Setting position for Fixed joint is error.
///
/// ```
/// use k::*;
/// let l0 = NodeBuilder::new()
/// .joint_type(JointType::Fixed)
/// .into_node();
/// assert!(l0.set_joint_position(0.0).is_err());
/// ```
///
/// `k::joint::Mimic` can be used to copy other joint's position.
///
/// ```
/// use k::*;
/// let j0 = NodeBuilder::new()
/// .joint_type(JointType::Linear{axis: Vector3::z_axis()})
/// .limits(Some((0.0..=2.0).into()))
/// .into_node();
/// let j1 = NodeBuilder::new()
/// .joint_type(JointType::Linear{axis: Vector3::z_axis()})
/// .limits(Some((0.0..=2.0).into()))
/// .into_node();
/// j1.set_mimic_parent(&j0, k::joint::Mimic::new(1.5, 0.1));
/// assert_eq!(j0.joint_position().unwrap(), 0.0);
/// assert_eq!(j1.joint_position().unwrap(), 0.0);
/// assert!(j0.set_joint_position(1.0).is_ok());
/// assert_eq!(j0.joint_position().unwrap(), 1.0);
/// assert_eq!(j1.joint_position().unwrap(), 1.6);
/// ```
pub fn set_joint_position(&self, position: T) -> Result<(), Error> {
let mut node = self.lock();
if node.mimic_parent.is_some() {
return Ok(());
}
node.joint.set_joint_position(position.clone())?;
for child in &node.mimic_children {
let mut child_node = child.lock();
let mimic = child_node.mimic.clone();
match mimic {
Some(m) => child_node
.joint
.set_joint_position(m.mimic_position(position.clone()))?,
None => {
let from = self.joint().name.to_owned();
let to = child.joint().name.to_owned();
return Err(Error::MimicError { from, to });
}
};
}
Ok(())
}
/// Set the clamped position (angle) of the joint
///
/// It refers to the joint limit and clamps the argument. This function does nothing if this is fixed joint.
///
/// # Examples
///
/// ```
/// use k::*;
/// let l0 = NodeBuilder::new()
/// .joint_type(JointType::Linear{axis: Vector3::z_axis()})
/// .limits(Some((-1.0..=1.0).into()))
/// .into_node();
/// l0.set_joint_position_clamped(2.0);
/// assert_eq!(l0.joint().joint_position(), Some(1.0));
/// l0.set_joint_position_clamped(-2.0);
/// assert_eq!(l0.joint().joint_position(), Some(-1.0));
/// ```
pub fn set_joint_position_clamped(&self, position: T) {
self.0
.lock()
.unwrap()
.joint
.set_joint_position_clamped(position);
}
#[inline]
pub fn set_joint_position_unchecked(&self, position: T) {
self.0
.lock()
.unwrap()
.joint
.set_joint_position_unchecked(position);
}
pub(crate) fn parent_world_transform(&self) -> Option<Isometry3<T>> {
//match self.0.borrow().parent {
match self.parent() {
Some(ref parent) => parent.world_transform(),
None => Some(Isometry3::identity()),
}
}
pub(crate) fn parent_world_velocity(&self) -> Option<Velocity<T>> {
match self.parent() {
Some(ref parent) => parent.world_velocity(),
None => Some(Velocity::zero()),
}
}
/// Get the calculated world transform.
/// Call `Chain::update_transforms()` before using this method.
///
/// # Examples
///
/// ```
/// use k::*;
/// use k::prelude::*;
///
/// let l0 = NodeBuilder::new()
/// .translation(Translation3::new(0.0, 0.0, 0.2))
/// .joint_type(JointType::Rotational{axis: Vector3::y_axis()})
/// .into_node();
/// let l1 = NodeBuilder::new()
/// .translation(Translation3::new(0.0, 0.0, 1.0))
/// .joint_type(JointType::Linear{axis: Vector3::z_axis()})
/// .into_node();
/// l1.set_parent(&l0);
/// let tree = Chain::<f64>::from_root(l0);
/// tree.set_joint_positions(&vec![3.141592 * 0.5, 0.1]).unwrap();
/// assert!(l1.world_transform().is_none());
/// assert!(l1.world_transform().is_none());
/// let _poses = tree.update_transforms();
/// assert!((l1.world_transform().unwrap().translation.vector.x - 1.1).abs() < 0.0001);
/// assert!((l1.world_transform().unwrap().translation.vector.z - 0.2).abs() < 0.0001);
///
/// // _poses[0] is as same as l0.world_transform()
/// // _poses[1] is as same as l1.world_transform()
#[inline]
pub fn world_transform(&self) -> Option<Isometry3<T>> {
self.joint().world_transform()
}
#[inline]
pub fn world_velocity(&self) -> Option<Velocity<T>> {
self.joint().world_velocity()
}
pub fn mimic_parent(&self) -> Option<Node<T>> {
match self.lock().mimic_parent {
Some(ref weak) => weak.upgrade().map(Node::from_arc),
None => None,
}
}
pub fn set_mimic_parent(&self, parent: &Node<T>, mimic: Mimic<T>) {
self.lock().mimic_parent = Some(Arc::downgrade(&parent.0));
parent.lock().mimic_children.push(self.clone());
self.lock().mimic = Some(mimic);
}
pub fn set_link(&self, link: Option<Link<T>>) {
self.lock().link = link;
}
pub fn link(&self) -> OptionLinkRefGuard<'_, T> {
OptionLinkRefGuard { guard: self.lock() }
}
}
impl<T> ::std::clone::Clone for Node<T>
where
T: RealField,
{
fn clone(&self) -> Self {
Node::<T>(self.0.clone())
}
}
impl<T> PartialEq for Node<T>
where
T: RealField,
{
fn eq(&self, other: &Node<T>) -> bool {
std::ptr::eq(&*self.0, &*other.0)
}
}
impl<T: RealField + SubsetOf<f64>> Display for Node<T> {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
let inner = self.lock();
inner.joint.fmt(f)?;
if let Some(l) = &inner.link {
write!(f, " => /{}/", l.name)?;
}
Ok(())
}
}
impl<T> From<Joint<T>> for Node<T>
where
T: RealField + SubsetOf<f64>,
{
fn from(joint: Joint<T>) -> Self {
Self::new(joint)
}
}
macro_rules! def_ref_guard {
($guard_struct:ident, $target:ty, $member:ident) => {
#[derive(Debug)]
pub struct $guard_struct<'a, T>
where
T: RealField,
{
guard: MutexGuard<'a, NodeImpl<T>>,
}
impl<T> Deref for $guard_struct<'_, T>
where
T: RealField,
{
type Target = $target;
fn deref(&self) -> &Self::Target {
&self.guard.$member
}
}
};
}
/*
macro_rules! def_ref_guard_mut {
($guard_struct:ident, $target:ty, $member:ident) => {
pub struct $guard_struct<'a, T>
where
T: RealField,
{
guard: RefMut<'a, NodeImpl<T>>,
}
impl<T> Deref for $guard_struct<'_, T>
where
T: RealField,
{
type Target = $target;
fn deref(&self) -> &Self::Target {
&self.guard.$member
}
}
impl<T> DerefMut for $guard_struct<'_, T>
where
T: RealField,
{
fn deref_mut(&mut self) -> &mut $target {
&mut self.guard.$member
}
}
};
}
*/
def_ref_guard!(JointRefGuard, Joint<T>, joint);
def_ref_guard!(OptionLinkRefGuard, Option<Link<T>>, link);
//def_ref_guard!(LinkRefGuard, Link<T>, link);
def_ref_guard!(ChildrenRefGuard, Vec<Node<T>>, children);
#[derive(Debug)]
pub struct LinkRefGuard<'a, T>
where
T: RealField,
{
pub(crate) guard: MutexGuard<'a, NodeImpl<T>>,
}
impl<T> Deref for LinkRefGuard<'_, T>
where
T: RealField,
{
type Target = Link<T>;
fn deref(&self) -> &Self::Target {
// danger
self.guard.link.as_ref().unwrap()
}
}
//def_ref_guard!(ParentRefGuard, Option<WeakNode<T>>, parent);
/*
pub struct ParentRefGuard<'a, T>
where
T: RealField,
{
guard: Ref<'a, NodeImpl<T>>,
parent: Option<Node<T>>,
}
impl<'a, T> ParentRefGuard<'a, T> where T:RealField {
pub fn new(guard: Ref<'a, NodeImpl<T>>) -> Self {
let parent = guard.parent.and_then(|weak| weak.upgrade().map(|arc| Node::from_arc(arc)));
Self {
guard,
parent,
}
}
}
*/
/*
impl<'a, T> Deref for ParentRefGuard<'a, T>
where
T: RealField,
{
type Target = Option<Node<T>>;
fn deref(&self) -> &Self::Target {
&self.parent
}
}
*/
//def_ref_guard_mut!(JointRefGuardMut, Joint<T>, joint);
/// Build a `Link<T>`
///
/// # Examples
///
/// ```
/// use k::*;
/// let l0 = NodeBuilder::new()
/// .name("link_pitch")
/// .translation(Translation3::new(0.0, 0.1, 0.0))
/// .joint_type( JointType::Rotational{axis: Vector3::y_axis()})
/// .finalize();
/// println!("{l0:?}");
/// ```
#[derive(Debug, Clone)]
pub struct NodeBuilder<T: RealField> {
name: String,
joint_type: JointType<T>,
limits: Option<Range<T>>,
origin: Isometry3<T>,
}
impl<T> Default for NodeBuilder<T>
where
T: RealField + SubsetOf<f64>,
{
fn default() -> Self {
Self::new()
}
}
impl<T> NodeBuilder<T>
where
T: RealField + SubsetOf<f64>,
{
pub fn new() -> NodeBuilder<T> {
NodeBuilder {
name: "".to_string(),
joint_type: JointType::Fixed,
limits: None,
origin: Isometry3::identity(),
}
}
/// Set the name of the `Link`
pub fn name(mut self, name: &str) -> NodeBuilder<T> {
self.name = name.to_string();
self
}
/// Set the joint which is connected to this link
pub fn joint_type(mut self, joint_type: JointType<T>) -> NodeBuilder<T> {
self.joint_type = joint_type;
self
}
/// Set joint limits
pub fn limits(mut self, limits: Option<Range<T>>) -> NodeBuilder<T> {
self.limits = limits;
self
}
/// Set the origin transform of this joint
pub fn origin(mut self, origin: Isometry3<T>) -> NodeBuilder<T> {
self.origin = origin;
self
}
/// Set the translation of the origin transform of this joint
pub fn translation(mut self, translation: Translation3<T>) -> NodeBuilder<T> {
self.origin.translation = translation;
self
}
/// Set the rotation of the origin transform of this joint
pub fn rotation(mut self, rotation: UnitQuaternion<T>) -> NodeBuilder<T> {
self.origin.rotation = rotation;
self
}
/// Create `Joint` instance
pub fn finalize(self) -> Joint<T> {
let mut joint = Joint::new(&self.name, self.joint_type);
joint.set_origin(self.origin);
joint.limits = self.limits;
joint
}
/// Create `Node` instead of `Joint` as output
pub fn into_node(self) -> Node<T> {
self.finalize().into()
}
}
/// set parents easily
///
/// ```
/// use k::connect;
/// # fn main() {
/// let l0 = k::NodeBuilder::<f64>::new().into_node();
/// let l1 = k::NodeBuilder::new().into_node();
/// let l2 = k::NodeBuilder::new().into_node();
///
/// // This is the same as below
/// // l1.set_parent(&l0);
/// // l2.set_parent(&l1);
/// connect![l0 => l1 => l2];
///
/// assert!(l0.is_root());
/// assert!(!l1.is_root());
/// assert!(!l1.is_end());
/// assert!(l2.is_end());
/// # }
/// ```
#[macro_export]
macro_rules! connect {
($x:expr => $y:expr) => {
$y.set_parent(&$x);
};
($x:expr => $y:expr => $($rest:tt)+) => {
$y.set_parent(&$x);
$crate::connect!($y => $($rest)*);
};
}